C19H20O12 — CID 162973772
(1S,3R,4R,5R)-3-(2-carboxyacetyl)oxy-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxycyclohexane-1-carboxylic acid (PubChem CID 162973772) has the molecular formula C19H20O12 and a molecular weight of 440.36 g/mol. Its IUPAC name is (1S,3R,4R,5R)-3-(2-carboxyacetyl)oxy-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5R)-3-(2-carboxyacetyl)oxy-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162973772 |
| Molecular Formula | C19H20O12 |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (1S,3R,4R,5R)-3-(2-carboxyacetyl)oxy-4-[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,5-dihydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)CC(=O)O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H20O12/c20-10-3-1-9(5-11(10)21)2-4-15(25)31-17-12(22)7-19(29,18(27)28)8-13(17)30-16(26)6-14(23)24/h1-5,12-13,17,20-22,29H,6-8H2,(H,23,24)(H,27,28)/t12-,13-,17-,19+/m1/s1 |
| InChIKey | QANFMVGDQHBVKF-REHIUZFUSA-N |
| XLogP | -0.62 |
| TPSA | 208.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|