C29H31NO10 — CID 90145778
[(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,5-dihydroxycyclohexyl] (E)-3-(3-hydroxy-4-methylphenyl)prop-2-enoate (PubChem CID 90145778) has the molecular formula C29H31NO10 and a molecular weight of 553.56 g/mol. Its IUPAC name is [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,5-dihydroxycyclohexyl] (E)-3-(3-hydroxy-4-methylphenyl)prop-2-enoate.
| Compound Name | [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,5-dihydroxycyclohexyl] (E)-3-(3-hydroxy-4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 90145778 |
| Molecular Formula | C29H31NO10 |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | [(1R,2R,3R,5S)-5-(cyclopropylcarbamoyl)-2-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3,5-dihydroxycyclohexyl] (E)-3-(3-hydroxy-4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)O[C@@H]2C[C@](O)(C(=O)NC3CC3)C[C@@H](O)[C@H]2OC(=O)/C=C/c2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C29H31NO10/c1-16-2-3-17(12-21(16)32)5-10-25(35)39-24-15-29(38,28(37)30-19-7-8-19)14-23(34)27(24)40-26(36)11-6-18-4-9-20(31)22(33)13-18/h2-6,9-13,19,23-24,27,31-34,38H,7-8,14-15H2,1H3,(H,30,37)/b10-5+,11-6+/t23-,24-,27-,29+/m1/s1 |
| InChIKey | MPVVSNRJXIMALQ-WSYCKURBSA-N |
| XLogP | 1.83 |
| TPSA | 182.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|