C26H28O12 — CID 71511550
methyl (1R,3R,4S,5R)-3-[3-(3,4-dihydroxyphenyl)propanoyloxy]-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,5-dihydroxycyclohexane-1-carboxylate (PubChem CID 71511550) has the molecular formula C26H28O12 and a molecular weight of 532.50 g/mol. Its IUPAC name is methyl (1R,3R,4S,5R)-3-[3-(3,4-dihydroxyphenyl)propanoyloxy]-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,5-dihydroxycyclohexane-1-carboxylate.
| Compound Name | methyl (1R,3R,4S,5R)-3-[3-(3,4-dihydroxyphenyl)propanoyloxy]-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,5-dihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71511550 |
| Molecular Formula | C26H28O12 |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | methyl (1R,3R,4S,5R)-3-[3-(3,4-dihydroxyphenyl)propanoyloxy]-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,5-dihydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C[C@@H](O)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)[C@H](OC(=O)CCc2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C26H28O12/c1-36-25(34)26(35)12-20(31)24(38-23(33)9-5-15-3-7-17(28)19(30)11-15)21(13-26)37-22(32)8-4-14-2-6-16(27)18(29)10-14/h2-3,5-7,9-11,20-21,24,27-31,35H,4,8,12-13H2,1H3/b9-5+/t20-,21-,24+,26-/m1/s1 |
| InChIKey | WUGMOXMHCCHGKG-SEBSFETASA-N |
| XLogP | 1.04 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|