C26H27NO11 — CID 25016861
[(1R,3R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,5-dihydroxy-5-(methylcarbamoyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 25016861) has the molecular formula C26H27NO11 and a molecular weight of 529.50 g/mol. Its IUPAC name is [(1R,3R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,5-dihydroxy-5-(methylcarbamoyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,3R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,5-dihydroxy-5-(methylcarbamoyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 25016861 |
| Molecular Formula | C26H27NO11 |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | [(1R,3R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-2,5-dihydroxy-5-(methylcarbamoyl)cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CNC(=O)C1(O)C[C@@H](OC(=O)/C=C/c2ccc(O)c(O)c2)C(O)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C26H27NO11/c1-27-25(35)26(36)12-20(37-22(32)8-4-14-2-6-16(28)18(30)10-14)24(34)21(13-26)38-23(33)9-5-15-3-7-17(29)19(31)11-15/h2-11,20-21,24,28-31,34,36H,12-13H2,1H3,(H,27,35)/b8-4+,9-5+/t20-,21-,24?,26?/m1/s1 |
| InChIKey | OZVBFLDPIIBDJK-IYVYCCGLSA-N |
| XLogP | 0.69 |
| TPSA | 203.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|