C27H42N2O12 — CID 58332678
[2,3,5-trihydroxy-5-[3-[2-[2-[3-(methoxyamino)propoxy]ethoxy]ethoxy]propylcarbamoyl]cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 58332678) has the molecular formula C27H42N2O12 and a molecular weight of 586.64 g/mol. Its IUPAC name is [2,3,5-trihydroxy-5-[3-[2-[2-[3-(methoxyamino)propoxy]ethoxy]ethoxy]propylcarbamoyl]cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [2,3,5-trihydroxy-5-[3-[2-[2-[3-(methoxyamino)propoxy]ethoxy]ethoxy]propylcarbamoyl]cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58332678 |
| Molecular Formula | C27H42N2O12 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | [2,3,5-trihydroxy-5-[3-[2-[2-[3-(methoxyamino)propoxy]ethoxy]ethoxy]propylcarbamoyl]cyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CONCCCOCCOCCOCCCNC(=O)C1(O)CC(O)C(O)C(OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C27H42N2O12/c1-37-29-9-3-11-39-13-15-40-14-12-38-10-2-8-28-26(35)27(36)17-22(32)25(34)23(18-27)41-24(33)7-5-19-4-6-20(30)21(31)16-19/h4-7,16,22-23,25,29-32,34,36H,2-3,8-15,17-18H2,1H3,(H,28,35)/b7-5+ |
| InChIKey | AMXFZXWHQRXTFG-FNORWQNLSA-N |
| XLogP | -0.63 |
| TPSA | 205.50 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|