C18H23NO7 — CID 138627164
[(1R,2R,5S)-5-(ethylcarbamoyl)-2,5-dihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 138627164) has the molecular formula C18H23NO7 and a molecular weight of 365.38 g/mol. Its IUPAC name is [(1R,2R,5S)-5-(ethylcarbamoyl)-2,5-dihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,2R,5S)-5-(ethylcarbamoyl)-2,5-dihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 138627164 |
| Molecular Formula | C18H23NO7 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | [(1R,2R,5S)-5-(ethylcarbamoyl)-2,5-dihydroxycyclohexyl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CCNC(=O)[C@]1(O)CC[C@@H](O)[C@H](OC(=O)/C=C/c2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C18H23NO7/c1-2-19-17(24)18(25)8-7-13(21)15(10-18)26-16(23)6-4-11-3-5-12(20)14(22)9-11/h3-6,9,13,15,20-22,25H,2,7-8,10H2,1H3,(H,19,24)/b6-4+/t13-,15-,18+/m1/s1 |
| InChIKey | ZSZQQQVBNYIKKA-KBKLEAOHSA-N |
| XLogP | 0.43 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|