C16H18O8 — CID 166464398
(1R,3R,4S)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxycyclohexane-1-carboxylic acid (PubChem CID 166464398) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is (1R,3R,4S)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxycyclohexane-1-carboxylic acid.
| Compound Name | (1R,3R,4S)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166464398 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (1R,3R,4S)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1CC[C@](O)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C16H18O8/c17-10-3-1-9(7-11(10)18)2-4-14(20)24-13-5-6-16(23,15(21)22)8-12(13)19/h1-4,7,12-13,17-19,23H,5-6,8H2,(H,21,22)/b4-2+/t12-,13+,16-/m1/s1 |
| InChIKey | NZHAXEDNFWXKBO-OTWHYEOFSA-N |
| XLogP | 0.38 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|