C25H26O12 — CID 166464397
(E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;(1R,3R,4S)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxycyclohexane-1-carboxylic acid (PubChem CID 166464397) has the molecular formula C25H26O12 and a molecular weight of 518.47 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;(1R,3R,4S)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxycyclohexane-1-carboxylic acid.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;(1R,3R,4S)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 166464397 |
| Molecular Formula | C25H26O12 |
| Molecular Weight | 518.47 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)prop-2-enoic acid;(1R,3R,4S)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,3-dihydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@H]1CC[C@](O)(C(=O)O)C[C@H]1O.O=C(O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H18O8.C9H8O4/c17-10-3-1-9(7-11(10)18)2-4-14(20)24-13-5-6-16(23,15(21)22)8-12(13)19;10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-4,7,12-13,17-19,23H,5-6,8H2,(H,21,22);1-5,10-11H,(H,12,13)/b2*4-2+/t12-,13+,16-;/m1./s1 |
| InChIKey | CLAJBBSSGRDOAE-BIEAJACISA-N |
| XLogP | 1.58 |
| TPSA | 222.28 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|