C16H18O8 — CID 176548575
3,4,5-trihydroxy-1-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid (PubChem CID 176548575) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is 3,4,5-trihydroxy-1-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-1-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 176548575 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 3,4,5-trihydroxy-1-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(O)cc1)OC1(C(=O)O)CC(O)C(O)C(O)C1 |
| InChI | InChI=1S/C16H18O8/c17-10-4-1-9(2-5-10)3-6-13(20)24-16(15(22)23)7-11(18)14(21)12(19)8-16/h1-6,11-12,14,17-19,21H,7-8H2,(H,22,23)/b6-3+ |
| InChIKey | SMTYFLZDZRNFJI-ZZXKWVIFSA-N |
| XLogP | -0.35 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|