C19H24O8 — CID 67758813
(1S,3S,4R,5R)-3,4-dihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1-propoxycyclohexane-1-carboxylic acid (PubChem CID 67758813) has the molecular formula C19H24O8 and a molecular weight of 380.39 g/mol. Its IUPAC name is (1S,3S,4R,5R)-3,4-dihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1-propoxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,3S,4R,5R)-3,4-dihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1-propoxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67758813 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (1S,3S,4R,5R)-3,4-dihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1-propoxycyclohexane-1-carboxylic acid |
| SMILES | CCCO[C@@]1(C(=O)O)C[C@H](O)[C@@H](O)[C@H](OC(=O)/C=C/c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C19H24O8/c1-2-9-26-19(18(24)25)10-14(21)17(23)15(11-19)27-16(22)8-5-12-3-6-13(20)7-4-12/h3-8,14-15,17,20-21,23H,2,9-11H2,1H3,(H,24,25)/b8-5+/t14-,15+,17+,19-/m0/s1 |
| InChIKey | ONUSBPUMWPMHFX-FWNYMQQESA-N |
| XLogP | 1.08 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|