C26H30O9 — CID 67759293
(1S,3S,4R,5R)-3,4-dihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1-[3-(3-methoxyphenyl)propoxy]cyclohexane-1-carboxylic acid (PubChem CID 67759293) has the molecular formula C26H30O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is (1S,3S,4R,5R)-3,4-dihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1-[3-(3-methoxyphenyl)propoxy]cyclohexane-1-carboxylic acid.
| Compound Name | (1S,3S,4R,5R)-3,4-dihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1-[3-(3-methoxyphenyl)propoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67759293 |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (1S,3S,4R,5R)-3,4-dihydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-1-[3-(3-methoxyphenyl)propoxy]cyclohexane-1-carboxylic acid |
| SMILES | COc1cccc(CCCO[C@@]2(C(=O)O)C[C@H](O)[C@@H](O)[C@H](OC(=O)/C=C/c3ccc(O)cc3)C2)c1 |
| InChI | InChI=1S/C26H30O9/c1-33-20-6-2-4-18(14-20)5-3-13-34-26(25(31)32)15-21(28)24(30)22(16-26)35-23(29)12-9-17-7-10-19(27)11-8-17/h2,4,6-12,14,21-22,24,27-28,30H,3,5,13,15-16H2,1H3,(H,31,32)/b12-9+/t21-,22+,24+,26-/m0/s1 |
| InChIKey | FCWIFZBDQCTOSV-FPCZCKKGSA-N |
| XLogP | 2.31 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|