C23H24O8 — CID 67848910
(1S,3S,4R,5R)-3,4-dihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-1-(phenoxymethyl)cyclohexane-1-carboxylic acid (PubChem CID 67848910) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is (1S,3S,4R,5R)-3,4-dihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-1-(phenoxymethyl)cyclohexane-1-carboxylic acid.
| Compound Name | (1S,3S,4R,5R)-3,4-dihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-1-(phenoxymethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 67848910 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (1S,3S,4R,5R)-3,4-dihydroxy-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]-1-(phenoxymethyl)cyclohexane-1-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(O)cc1)O[C@@H]1C[C@@](COc2ccccc2)(C(=O)O)C[C@H](O)[C@H]1O |
| InChI | InChI=1S/C23H24O8/c24-16-9-6-15(7-10-16)8-11-20(26)31-19-13-23(22(28)29,12-18(25)21(19)27)14-30-17-4-2-1-3-5-17/h1-11,18-19,21,24-25,27H,12-14H2,(H,28,29)/t18-,19+,21+,23-/m0/s1 |
| InChIKey | QKNYQUIPYHCSPA-KPYOPSEVSA-N |
| XLogP | 1.98 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|