C34H30O15 — CID 131636627
trans-(3R,5R)-1,3,5-tris[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 131636627) has the molecular formula C34H30O15 and a molecular weight of 678.60 g/mol. Its IUPAC name is trans-(3R,5R)-1,3,5-tris[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | trans-(3R,5R)-1,3,5-tris[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 131636627 |
| Molecular Formula | C34H30O15 |
| Molecular Weight | 678.60 g/mol |
| Exact Mass | 678.16 |
| IUPAC Name | trans-(3R,5R)-1,3,5-tris[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)O[C@@H]1CC(OC(=O)C=Cc2ccc(O)c(O)c2)(C(=O)O)C[C@@H](OC(=O)C=Cc2ccc(O)c(O)c2)C1O |
| InChI | InChI=1S/C34H30O15/c35-21-7-1-18(13-24(21)38)4-10-29(41)47-27-16-34(33(45)46,49-31(43)12-6-20-3-9-23(37)26(40)15-20)17-28(32(27)44)48-30(42)11-5-19-2-8-22(36)25(39)14-19/h1-15,27-28,32,35-40,44H,16-17H2,(H,45,46)/t27-,28-,32?,34?/m1/s1 |
| InChIKey | MSKVJEAKVWAQTA-QTLOJIOFSA-N |
| XLogP | 2.71 |
| TPSA | 257.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.60 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|