C29H30O13 — CID 162893089
3,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxy-1-(2-methylpropanoyloxy)cyclohexane-1-carboxylic acid (PubChem CID 162893089) has the molecular formula C29H30O13 and a molecular weight of 586.55 g/mol. Its IUPAC name is 3,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxy-1-(2-methylpropanoyloxy)cyclohexane-1-carboxylic acid.
| Compound Name | 3,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxy-1-(2-methylpropanoyloxy)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162893089 |
| Molecular Formula | C29H30O13 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 3,5-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-4-hydroxy-1-(2-methylpropanoyloxy)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)C(=O)OC1(C(=O)O)CC(OC(=O)C=Cc2ccc(O)c(O)c2)C(O)C(OC(=O)C=Cc2ccc(O)c(O)c2)C1 |
| InChI | InChI=1S/C29H30O13/c1-15(2)27(37)42-29(28(38)39)13-22(40-24(34)9-5-16-3-7-18(30)20(32)11-16)26(36)23(14-29)41-25(35)10-6-17-4-8-19(31)21(33)12-17/h3-12,15,22-23,26,30-33,36H,13-14H2,1-2H3,(H,38,39) |
| InChIKey | XNFNPKMIOPRXMH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 217.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|