C29H28O15 — CID 163016116
4-(3-carboxypropanoyloxy)-1,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-5-hydroxycyclohexane-1-carboxylic acid (PubChem CID 163016116) has the molecular formula C29H28O15 and a molecular weight of 616.53 g/mol. Its IUPAC name is 4-(3-carboxypropanoyloxy)-1,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-5-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-(3-carboxypropanoyloxy)-1,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-5-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 163016116 |
| Molecular Formula | C29H28O15 |
| Molecular Weight | 616.53 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | 4-(3-carboxypropanoyloxy)-1,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-5-hydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(O)CCC(=O)OC1C(O)CC(OC(=O)C=Cc2ccc(O)c(O)c2)(C(=O)O)CC1OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C29H28O15/c30-17-5-1-15(11-19(17)32)3-8-24(37)42-22-14-29(28(40)41,13-21(34)27(22)43-25(38)10-7-23(35)36)44-26(39)9-4-16-2-6-18(31)20(33)12-16/h1-6,8-9,11-12,21-22,27,30-34H,7,10,13-14H2,(H,35,36)(H,40,41) |
| InChIKey | KMMYGGBDWQYIPW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 254.65 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.53 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|