C25H24O12 — CID 97050299
(1R,2R,3R,4R)-1,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2,4-dihydroxycyclohexane-1-carboxylic acid (PubChem CID 97050299) has the molecular formula C25H24O12 and a molecular weight of 516.46 g/mol. Its IUPAC name is (1R,2R,3R,4R)-1,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2,4-dihydroxycyclohexane-1-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-1,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2,4-dihydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 97050299 |
| Molecular Formula | C25H24O12 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | (1R,2R,3R,4R)-1,3-bis[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]-2,4-dihydroxycyclohexane-1-carboxylic acid |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1[C@H](O)CC[C@](OC(=O)/C=C/c2ccc(O)c(O)c2)(C(=O)O)[C@@H]1O |
| InChI | InChI=1S/C25H24O12/c26-15-5-1-13(11-18(15)29)3-7-20(31)36-22-17(28)9-10-25(23(22)33,24(34)35)37-21(32)8-4-14-2-6-16(27)19(30)12-14/h1-8,11-12,17,22-23,26-30,33H,9-10H2,(H,34,35)/b7-3+,8-4+/t17-,22-,23-,25-/m1/s1 |
| InChIKey | NHLROEQWBKMPPH-ZDKLQZKUSA-N |
| XLogP | 1.03 |
| TPSA | 211.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|