C26H26O12 — CID 163097613
methyl (1R,2S,3S,4R)-2,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4-dihydroxycyclohexane-1-carboxylate (PubChem CID 163097613) has the molecular formula C26H26O12 and a molecular weight of 530.48 g/mol. Its IUPAC name is methyl (1R,2S,3S,4R)-2,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4-dihydroxycyclohexane-1-carboxylate.
| Compound Name | methyl (1R,2S,3S,4R)-2,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4-dihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 163097613 |
| Molecular Formula | C26H26O12 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | methyl (1R,2S,3S,4R)-2,3-bis[3-(3,4-dihydroxyphenyl)prop-2-enoyloxy]-1,4-dihydroxycyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(O)CC[C@@H](O)[C@H](OC(=O)C=Cc2ccc(O)c(O)c2)[C@@H]1OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C26H26O12/c1-36-25(34)26(35)11-10-18(29)23(37-21(32)8-4-14-2-6-16(27)19(30)12-14)24(26)38-22(33)9-5-15-3-7-17(28)20(31)13-15/h2-9,12-13,18,23-24,27-31,35H,10-11H2,1H3/t18-,23+,24+,26-/m1/s1 |
| InChIKey | BRUFZEFYYGQFSU-OCBMDVHSSA-N |
| XLogP | 1.12 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|