C27H36O5 — CID 164903423
[(1S,2R,5S,7R,8R)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl] (E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoate (PubChem CID 164903423) has the molecular formula C27H36O5 and a molecular weight of 440.58 g/mol. Its IUPAC name is [(1S,2R,5S,7R,8R)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl] (E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoate.
| Compound Name | [(1S,2R,5S,7R,8R)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl] (E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 164903423 |
| Molecular Formula | C27H36O5 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | [(1S,2R,5S,7R,8R)-2,6,6,8-tetramethyl-8-tricyclo[5.3.1.01,5]undecanyl] (E)-3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@]2(C)CC[C@@]34C[C@@H]2C(C)(C)[C@@H]3CC[C@H]4C)ccc1OC(C)=O |
| InChI | InChI=1S/C27H36O5/c1-17-7-11-22-25(3,4)23-16-27(17,22)14-13-26(23,5)32-24(29)12-9-19-8-10-20(31-18(2)28)21(15-19)30-6/h8-10,12,15,17,22-23H,7,11,13-14,16H2,1-6H3/b12-9+/t17-,22+,23-,26-,27+/m1/s1 |
| InChIKey | FWTKYZHGHDAAGQ-TUOTZWKRSA-N |
| XLogP | 5.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|