C21H27NO6 — CID 139608671
methyl 4-[3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoylamino]-1-methylcyclohexane-1-carboxylate (PubChem CID 139608671) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is methyl 4-[3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoylamino]-1-methylcyclohexane-1-carboxylate.
| Compound Name | methyl 4-[3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoylamino]-1-methylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 139608671 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | methyl 4-[3-(4-acetyloxy-3-methoxyphenyl)prop-2-enoylamino]-1-methylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(C)CCC(NC(=O)C=Cc2ccc(OC(C)=O)c(OC)c2)CC1 |
| InChI | InChI=1S/C21H27NO6/c1-14(23)28-17-7-5-15(13-18(17)26-3)6-8-19(24)22-16-9-11-21(2,12-10-16)20(25)27-4/h5-8,13,16H,9-12H2,1-4H3,(H,22,24) |
| InChIKey | MDBQJLQDZSEECP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|