C20H27NO4 — CID 19004770
[4-[(E)-3-[(4,4-dimethylcyclohexyl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate (PubChem CID 19004770) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is [4-[(E)-3-[(4,4-dimethylcyclohexyl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[(E)-3-[(4,4-dimethylcyclohexyl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 19004770 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | [4-[(E)-3-[(4,4-dimethylcyclohexyl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)NC2CCC(C)(C)CC2)ccc1OC(C)=O |
| InChI | InChI=1S/C20H27NO4/c1-14(22)25-17-7-5-15(13-18(17)24-4)6-8-19(23)21-16-9-11-20(2,3)12-10-16/h5-8,13,16H,9-12H2,1-4H3,(H,21,23)/b8-6+ |
| InChIKey | QPVJDZJVXPGNBJ-SOFGYWHQSA-N |
| XLogP | 3.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|