About (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate
(3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate (PubChem CID 121368423) has the molecular formula C13H22O4
and a molecular weight of 242.31 g/mol. Its IUPAC name is (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate.
Analyze (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate?
The IUPAC name of (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate (CID 121368423) is (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate.
What is the SMILES notation for (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate?
The canonical SMILES for (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate is CCC(C)(C)C(=O)OC1(C)COC(=O)C1(C)C.
What is the InChIKey of (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate?
The InChIKey is BUCCZWCDQPLBQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4/c1-7-11(2,3)9(14)17-13(6)8-16-10(15)12(13,4)5/h7-8H2,1-6H3.
What are the key properties of (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate?
(3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate has a molecular weight of 242.31 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4,4-trimethyl-5-oxooxolan-3-yl) 2,2-dimethylbutanoate is sourced from PubChem (CID 121368423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).