C16H26O6 — CID 20686217
[1-(4,4-dimethyl-2-oxooxolan-3-yl)oxy-2-methyl-1-oxopropan-2-yl] 2,2-dimethylbutanoate (PubChem CID 20686217) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is [1-(4,4-dimethyl-2-oxooxolan-3-yl)oxy-2-methyl-1-oxopropan-2-yl] 2,2-dimethylbutanoate.
| Compound Name | [1-(4,4-dimethyl-2-oxooxolan-3-yl)oxy-2-methyl-1-oxopropan-2-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 20686217 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | [1-(4,4-dimethyl-2-oxooxolan-3-yl)oxy-2-methyl-1-oxopropan-2-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)(C)C(=O)OC1C(=O)OCC1(C)C |
| InChI | InChI=1S/C16H26O6/c1-8-14(2,3)12(18)22-16(6,7)13(19)21-10-11(17)20-9-15(10,4)5/h10H,8-9H2,1-7H3 |
| InChIKey | ICSBGVKQPLJUEK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|