C11H17BrO4 — CID 15517932
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-bromo-3-methylbutanoate (PubChem CID 15517932) has the molecular formula C11H17BrO4 and a molecular weight of 293.16 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-bromo-3-methylbutanoate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-bromo-3-methylbutanoate |
|---|---|
| PubChem CID | 15517932 |
| Molecular Formula | C11H17BrO4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] 2-bromo-3-methylbutanoate |
| SMILES | CC(C)C(Br)C(=O)O[C@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C11H17BrO4/c1-6(2)7(12)9(13)16-8-10(14)15-5-11(8,3)4/h6-8H,5H2,1-4H3/t7?,8-/m0/s1 |
| InChIKey | BXBXLHOVWMKBJK-MQWKRIRWSA-N |
| XLogP | 1.90 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|