(4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate

C12H19NO5 — CID 170264942

IUPAC(4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate
SMILESCC1(C)COC(=O)C1OC(=O)CN1CCOCC1
InChIInChI=1S/C12H19NO5/c1-12(2)8-17-11(15)10(12)18-9(14)7-13-3-5-16-6-4-13/h10H,3-8H2,1-2H3
InChIKeyUQGWIBPIVOYXKP-UHFFFAOYSA-N
MW257.29 g/mol
LogP-0.19
Rot. Bonds3

About (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate

(4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate (PubChem CID 170264942) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate.

Molecular Properties

Compound Name(4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate
PubChem CID170264942
Molecular FormulaC12H19NO5
Molecular Weight257.29 g/mol
Exact Mass257.13
IUPAC Name(4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate
SMILESCC1(C)COC(=O)C1OC(=O)CN1CCOCC1
InChIInChI=1S/C12H19NO5/c1-12(2)8-17-11(15)10(12)18-9(14)7-13-3-5-16-6-4-13/h10H,3-8H2,1-2H3
InChIKeyUQGWIBPIVOYXKP-UHFFFAOYSA-N
XLogP-0.19
TPSA65.07 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.29
LogP ≤ 5-0.19
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate?
The IUPAC name of (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate (CID 170264942) is (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate.
What is the SMILES notation for (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate?
The canonical SMILES for (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate is CC1(C)COC(=O)C1OC(=O)CN1CCOCC1.
What is the InChIKey of (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate?
The InChIKey is UQGWIBPIVOYXKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5/c1-12(2)8-17-11(15)10(12)18-9(14)7-13-3-5-16-6-4-13/h10H,3-8H2,1-2H3.
What are the key properties of (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate?
(4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate has a molecular weight of 257.29 g/mol, XLogP of -0.19, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate is sourced from PubChem (CID 170264942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).