C12H19NO5 — CID 170264942
(4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate (PubChem CID 170264942) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate.
| Compound Name | (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate |
|---|---|
| PubChem CID | 170264942 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (4,4-dimethyl-2-oxooxolan-3-yl) 2-morpholin-4-ylacetate |
| SMILES | CC1(C)COC(=O)C1OC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C12H19NO5/c1-12(2)8-17-11(15)10(12)18-9(14)7-13-3-5-16-6-4-13/h10H,3-8H2,1-2H3 |
| InChIKey | UQGWIBPIVOYXKP-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |