C16H23NO7S2 — CID 54481795
(8,8-diethyl-7,9-dioxo-6,10-dioxa-1,4-dithiaspiro[4.5]decan-3-yl) 2-morpholin-4-ylacetate (PubChem CID 54481795) has the molecular formula C16H23NO7S2 and a molecular weight of 405.49 g/mol. Its IUPAC name is (8,8-diethyl-7,9-dioxo-6,10-dioxa-1,4-dithiaspiro[4.5]decan-3-yl) 2-morpholin-4-ylacetate.
| Compound Name | (8,8-diethyl-7,9-dioxo-6,10-dioxa-1,4-dithiaspiro[4.5]decan-3-yl) 2-morpholin-4-ylacetate |
|---|---|
| PubChem CID | 54481795 |
| Molecular Formula | C16H23NO7S2 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | (8,8-diethyl-7,9-dioxo-6,10-dioxa-1,4-dithiaspiro[4.5]decan-3-yl) 2-morpholin-4-ylacetate |
| SMILES | CCC1(CC)C(=O)OC2(OC1=O)SCC(OC(=O)CN1CCOCC1)S2 |
| InChI | InChI=1S/C16H23NO7S2/c1-3-15(4-2)13(19)23-16(24-14(15)20)25-10-12(26-16)22-11(18)9-17-5-7-21-8-6-17/h12H,3-10H2,1-2H3 |
| InChIKey | XPMVMNLYQVMSJS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|