C20H31NO7S2 — CID 3046406
dibutyl 2-[4-(2-morpholin-4-ylacetyl)oxy-1,3-dithiolan-2-ylidene]propanedioate (PubChem CID 3046406) has the molecular formula C20H31NO7S2 and a molecular weight of 461.60 g/mol. Its IUPAC name is dibutyl 2-[4-(2-morpholin-4-ylacetyl)oxy-1,3-dithiolan-2-ylidene]propanedioate.
| Compound Name | dibutyl 2-[4-(2-morpholin-4-ylacetyl)oxy-1,3-dithiolan-2-ylidene]propanedioate |
|---|---|
| PubChem CID | 3046406 |
| Molecular Formula | C20H31NO7S2 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | dibutyl 2-[4-(2-morpholin-4-ylacetyl)oxy-1,3-dithiolan-2-ylidene]propanedioate |
| SMILES | CCCCOC(=O)C(C(=O)OCCCC)=C1SCC(OC(=O)CN2CCOCC2)S1 |
| InChI | InChI=1S/C20H31NO7S2/c1-3-5-9-26-18(23)17(19(24)27-10-6-4-2)20-29-14-16(30-20)28-15(22)13-21-7-11-25-12-8-21/h16H,3-14H2,1-2H3 |
| InChIKey | KXNZQJCJWDFEKT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|