C12H17BrO4 — CID 134988547
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (Z)-2-bromohex-3-enoate (PubChem CID 134988547) has the molecular formula C12H17BrO4 and a molecular weight of 305.17 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (Z)-2-bromohex-3-enoate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (Z)-2-bromohex-3-enoate |
|---|---|
| PubChem CID | 134988547 |
| Molecular Formula | C12H17BrO4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (Z)-2-bromohex-3-enoate |
| SMILES | CC/C=C\C(Br)C(=O)O[C@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C12H17BrO4/c1-4-5-6-8(13)10(14)17-9-11(15)16-7-12(9,2)3/h5-6,8-9H,4,7H2,1-3H3/b6-5-/t8?,9-/m0/s1 |
| InChIKey | FQQBPMDFAWMYER-TUPGOYSDSA-N |
| XLogP | 2.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|