C23H27NO6 — CID 102245243
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-3-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 102245243) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-3-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-3-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 102245243 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2R)-3-cyclohexyl-2-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | CC1(C)COC(=O)[C@@H]1OC(=O)[C@@H](CC1CCCCC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H27NO6/c1-23(2)13-29-22(28)18(23)30-21(27)17(12-14-8-4-3-5-9-14)24-19(25)15-10-6-7-11-16(15)20(24)26/h6-7,10-11,14,17-18H,3-5,8-9,12-13H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | BEFOVKFWWYMQNX-MSOLQXFVSA-N |
| XLogP | 3.12 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|