C31H35NO15 — CID 102245248
[(3S)-4,4-dimethyl-2-oxooxolan-3-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate (PubChem CID 102245248) has the molecular formula C31H35NO15 and a molecular weight of 661.61 g/mol. Its IUPAC name is [(3S)-4,4-dimethyl-2-oxooxolan-3-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate.
| Compound Name | [(3S)-4,4-dimethyl-2-oxooxolan-3-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate |
|---|---|
| PubChem CID | 102245248 |
| Molecular Formula | C31H35NO15 |
| Molecular Weight | 661.61 g/mol |
| Exact Mass | 661.20 |
| IUPAC Name | [(3S)-4,4-dimethyl-2-oxooxolan-3-yl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-[(2R,3S,4R,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]propanoate |
| SMILES | CC(=O)OC[C@H]1O[C@H](C[C@@H](C(=O)O[C@@H]2C(=O)OCC2(C)C)N2C(=O)c3ccccc3C2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C31H35NO15/c1-14(33)41-12-22-24(44-16(3)35)25(45-17(4)36)23(43-15(2)34)21(46-22)11-20(29(39)47-26-30(40)42-13-31(26,5)6)32-27(37)18-9-7-8-10-19(18)28(32)38/h7-10,20-26H,11-13H2,1-6H3/t20-,21+,22+,23-,24+,25+,26+/m0/s1 |
| InChIKey | LBHSMRFAFGNNFR-BDBFOWHMSA-N |
| XLogP | 0.66 |
| TPSA | 204.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.61 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|