C18H22FNO3 — CID 70945620
methyl (2S)-3-cyclohexyl-2-(7-fluoro-3-oxo-1H-isoindol-2-yl)propanoate (PubChem CID 70945620) has the molecular formula C18H22FNO3 and a molecular weight of 319.38 g/mol. Its IUPAC name is methyl (2S)-3-cyclohexyl-2-(7-fluoro-3-oxo-1H-isoindol-2-yl)propanoate.
| Compound Name | methyl (2S)-3-cyclohexyl-2-(7-fluoro-3-oxo-1H-isoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 70945620 |
| Molecular Formula | C18H22FNO3 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | methyl (2S)-3-cyclohexyl-2-(7-fluoro-3-oxo-1H-isoindol-2-yl)propanoate |
| SMILES | COC(=O)[C@H](CC1CCCCC1)N1Cc2c(F)cccc2C1=O |
| InChI | InChI=1S/C18H22FNO3/c1-23-18(22)16(10-12-6-3-2-4-7-12)20-11-14-13(17(20)21)8-5-9-15(14)19/h5,8-9,12,16H,2-4,6-7,10-11H2,1H3/t16-/m0/s1 |
| InChIKey | QQRHQVUISFVKEK-INIZCTEOSA-N |
| XLogP | 3.29 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |