C12H19BrO4 — CID 11109577
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2S)-2-bromo-3,3-dimethylbutanoate (PubChem CID 11109577) has the molecular formula C12H19BrO4 and a molecular weight of 307.18 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2S)-2-bromo-3,3-dimethylbutanoate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2S)-2-bromo-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 11109577 |
| Molecular Formula | C12H19BrO4 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (2S)-2-bromo-3,3-dimethylbutanoate |
| SMILES | CC(C)(C)[C@H](Br)C(=O)O[C@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C12H19BrO4/c1-11(2,3)7(13)9(14)17-8-10(15)16-6-12(8,4)5/h7-8H,6H2,1-5H3/t7-,8+/m1/s1 |
| InChIKey | TUDFVIWKUJHXGN-SFYZADRCSA-N |
| XLogP | 2.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|