About (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane
(4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane (PubChem CID 144704866) has the molecular formula C14H26O4
and a molecular weight of 258.36 g/mol. Its IUPAC name is (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane.
Analyze (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane?
The IUPAC name of (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane (CID 144704866) is (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane.
What is the SMILES notation for (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane?
The canonical SMILES for (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane is CC.CCC(C)(C)C(=O)OC1C(=O)OCC1(C)C.
What is the InChIKey of (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane?
The InChIKey is UZRRFTGMENUYJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4.C2H6/c1-6-11(2,3)10(14)16-8-9(13)15-7-12(8,4)5;1-2/h8H,6-7H2,1-5H3;1-2H3.
What are the key properties of (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane?
(4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane has a molecular weight of 258.36 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-2-oxooxolan-3-yl) 2,2-dimethylbutanoate;ethane is sourced from PubChem (CID 144704866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).