C13H20O4 — CID 11287907
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-2,4-dimethylpent-2-enoate (PubChem CID 11287907) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-2,4-dimethylpent-2-enoate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-2,4-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 11287907 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (E)-2,4-dimethylpent-2-enoate |
| SMILES | C/C(=C\C(C)C)C(=O)O[C@H]1C(=O)OCC1(C)C |
| InChI | InChI=1S/C13H20O4/c1-8(2)6-9(3)11(14)17-10-12(15)16-7-13(10,4)5/h6,8,10H,7H2,1-5H3/b9-6+/t10-/m0/s1 |
| InChIKey | XPCWXIFEYPOJHB-ZKXNXJMVSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|