C16H26O6 — CID 20686246
(2-oxooxolan-3-yl) 2-(2,2-dimethylbutanoyloxy)-2-ethylbutanoate (PubChem CID 20686246) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2-(2,2-dimethylbutanoyloxy)-2-ethylbutanoate.
| Compound Name | (2-oxooxolan-3-yl) 2-(2,2-dimethylbutanoyloxy)-2-ethylbutanoate |
|---|---|
| PubChem CID | 20686246 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (2-oxooxolan-3-yl) 2-(2,2-dimethylbutanoyloxy)-2-ethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(CC)(CC)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C16H26O6/c1-6-15(4,5)13(18)22-16(7-2,8-3)14(19)21-11-9-10-20-12(11)17/h11H,6-10H2,1-5H3 |
| InChIKey | CWAVHGHGBMJMBB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|