C20H34O8 — CID 158325224
1,4-dioxan-2-yl 2,2-dimethylbutanoate;(2-oxooxolan-3-yl) 2,2-dimethylbutanoate (PubChem CID 158325224) has the molecular formula C20H34O8 and a molecular weight of 402.48 g/mol. Its IUPAC name is 1,4-dioxan-2-yl 2,2-dimethylbutanoate;(2-oxooxolan-3-yl) 2,2-dimethylbutanoate.
| Compound Name | 1,4-dioxan-2-yl 2,2-dimethylbutanoate;(2-oxooxolan-3-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 158325224 |
| Molecular Formula | C20H34O8 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1,4-dioxan-2-yl 2,2-dimethylbutanoate;(2-oxooxolan-3-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCOC1=O.CCC(C)(C)C(=O)OC1COCCO1 |
| InChI | InChI=1S/C10H18O4.C10H16O4/c1-4-10(2,3)9(11)14-8-7-12-5-6-13-8;1-4-10(2,3)9(12)14-7-5-6-13-8(7)11/h8H,4-7H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | GPIBAALKPPYCDX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|