C12H20O4 — CID 167550898
(3-methyl-2-oxooxan-4-yl) 2,2-dimethylbutanoate (PubChem CID 167550898) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3-methyl-2-oxooxan-4-yl) 2,2-dimethylbutanoate.
| Compound Name | (3-methyl-2-oxooxan-4-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 167550898 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3-methyl-2-oxooxan-4-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1CCOC(=O)C1C |
| InChI | InChI=1S/C12H20O4/c1-5-12(3,4)11(14)16-9-6-7-15-10(13)8(9)2/h8-9H,5-7H2,1-4H3 |
| InChIKey | PMSOJALGIZJLNC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |