C14H24O4 — CID 163604327
(2-oxooxolan-3-yl) 2,3-dimethyl-2-propylpentanoate (PubChem CID 163604327) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2,3-dimethyl-2-propylpentanoate.
| Compound Name | (2-oxooxolan-3-yl) 2,3-dimethyl-2-propylpentanoate |
|---|---|
| PubChem CID | 163604327 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (2-oxooxolan-3-yl) 2,3-dimethyl-2-propylpentanoate |
| SMILES | CCCC(C)(C(=O)OC1CCOC1=O)C(C)CC |
| InChI | InChI=1S/C14H24O4/c1-5-8-14(4,10(3)6-2)13(16)18-11-7-9-17-12(11)15/h10-11H,5-9H2,1-4H3 |
| InChIKey | HALJUFNHZJKJGK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |