C17H25F3O6 — CID 91544709
1-O-(2-oxooxolan-3-yl) 7-O-(2,2,2-trifluoroethyl) 2-ethyl-2,6-dimethylheptanedioate (PubChem CID 91544709) has the molecular formula C17H25F3O6 and a molecular weight of 382.38 g/mol. Its IUPAC name is 1-O-(2-oxooxolan-3-yl) 7-O-(2,2,2-trifluoroethyl) 2-ethyl-2,6-dimethylheptanedioate.
| Compound Name | 1-O-(2-oxooxolan-3-yl) 7-O-(2,2,2-trifluoroethyl) 2-ethyl-2,6-dimethylheptanedioate |
|---|---|
| PubChem CID | 91544709 |
| Molecular Formula | C17H25F3O6 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-O-(2-oxooxolan-3-yl) 7-O-(2,2,2-trifluoroethyl) 2-ethyl-2,6-dimethylheptanedioate |
| SMILES | CCC(C)(CCCC(C)C(=O)OCC(F)(F)F)C(=O)OC1CCOC1=O |
| InChI | InChI=1S/C17H25F3O6/c1-4-16(3,15(23)26-12-7-9-24-14(12)22)8-5-6-11(2)13(21)25-10-17(18,19)20/h11-12H,4-10H2,1-3H3 |
| InChIKey | URKWTHAWSIMDGN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|