C13H17F7O2 — CID 118595030
(1,3,3,4,4,5,5-heptafluorocyclohexyl)methyl 2,2-dimethylbutanoate (PubChem CID 118595030) has the molecular formula C13H17F7O2 and a molecular weight of 338.26 g/mol. Its IUPAC name is (1,3,3,4,4,5,5-heptafluorocyclohexyl)methyl 2,2-dimethylbutanoate.
| Compound Name | (1,3,3,4,4,5,5-heptafluorocyclohexyl)methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118595030 |
| Molecular Formula | C13H17F7O2 |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | (1,3,3,4,4,5,5-heptafluorocyclohexyl)methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC1(F)CC(F)(F)C(F)(F)C(F)(F)C1 |
| InChI | InChI=1S/C13H17F7O2/c1-4-9(2,3)8(21)22-7-10(14)5-11(15,16)13(19,20)12(17,18)6-10/h4-7H2,1-3H3 |
| InChIKey | KSYBYGBZWMDTHE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|