C11H12F7IO4 — CID 134565476
[2,2,4,4-tetrafluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-3-yl] 2-iodo-2-methylbutanoate (PubChem CID 134565476) has the molecular formula C11H12F7IO4 and a molecular weight of 468.10 g/mol. Its IUPAC name is [2,2,4,4-tetrafluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-3-yl] 2-iodo-2-methylbutanoate.
| Compound Name | [2,2,4,4-tetrafluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-3-yl] 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 134565476 |
| Molecular Formula | C11H12F7IO4 |
| Molecular Weight | 468.10 g/mol |
| Exact Mass | 467.97 |
| IUPAC Name | [2,2,4,4-tetrafluoro-5-hydroxy-3-methyl-5-(trifluoromethyl)oxolan-3-yl] 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1(C)C(F)(F)OC(O)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C11H12F7IO4/c1-4-6(2,19)5(20)22-7(3)8(12,13)9(21,10(14,15)16)23-11(7,17)18/h21H,4H2,1-3H3 |
| InChIKey | VYLYDXCNHCVSIQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.10 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|