C15H20F5IO3 — CID 138474338
2-[6,6-difluoro-5-hydroxy-5-(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-iodo-2-methylbutanoate (PubChem CID 138474338) has the molecular formula C15H20F5IO3 and a molecular weight of 470.22 g/mol. Its IUPAC name is 2-[6,6-difluoro-5-hydroxy-5-(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-iodo-2-methylbutanoate.
| Compound Name | 2-[6,6-difluoro-5-hydroxy-5-(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 138474338 |
| Molecular Formula | C15H20F5IO3 |
| Molecular Weight | 470.22 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 2-[6,6-difluoro-5-hydroxy-5-(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OCCC1CC2CC1C(F)(F)C2(O)C(F)(F)F |
| InChI | InChI=1S/C15H20F5IO3/c1-3-12(2,21)11(22)24-5-4-8-6-9-7-10(8)14(16,17)13(9,23)15(18,19)20/h8-10,23H,3-7H2,1-2H3 |
| InChIKey | VPLWUVZAGIYOQD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|