C20H36O2 — CID 15851152
6-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hexyl 2,2-dimethylpropanoate (PubChem CID 15851152) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 6-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hexyl 2,2-dimethylpropanoate.
| Compound Name | 6-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hexyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 15851152 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 6-[(1S,2S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hexyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCCCCC[C@H]1CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C20H36O2/c1-19(2,3)18(21)22-13-9-7-6-8-10-15-11-12-16-14-17(15)20(16,4)5/h15-17H,6-14H2,1-5H3/t15-,16-,17-/m0/s1 |
| InChIKey | KOVPHBMWXGYZTF-ULQDDVLXSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|