About (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate
(2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate (PubChem CID 129168469) has the molecular formula C15H23IO3
and a molecular weight of 378.25 g/mol. Its IUPAC name is (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate.
Molecular Properties
| Compound Name | (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate |
| PubChem CID | 129168469 |
| Molecular Formula | C15H23IO3 |
| Molecular Weight | 378.25 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1OCC2C3CCC(C3)C12C |
| InChI | InChI=1S/C15H23IO3/c1-4-14(2,16)12(17)19-13-15(3)10-6-5-9(7-10)11(15)8-18-13/h9-11,13H,4-8H2,1-3H3 |
| InChIKey | LFYOPYXTTWKSEX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate?
The IUPAC name of (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate (CID 129168469) is (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate.
What is the SMILES notation for (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate?
The canonical SMILES for (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate is CCC(C)(I)C(=O)OC1OCC2C3CCC(C3)C12C.
What is the InChIKey of (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate?
The InChIKey is LFYOPYXTTWKSEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23IO3/c1-4-14(2,16)12(17)19-13-15(3)10-6-5-9(7-10)11(15)8-18-13/h9-11,13H,4-8H2,1-3H3.
What are the key properties of (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate?
(2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate has a molecular weight of 378.25 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-4-oxatricyclo[5.2.1.02,6]decan-3-yl) 2-iodo-2-methylbutanoate is sourced from PubChem (CID 129168469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).