C15H23IO4 — CID 130310997
(5-methoxy-5-methyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2-methylbutanoate (PubChem CID 130310997) has the molecular formula C15H23IO4 and a molecular weight of 394.25 g/mol. Its IUPAC name is (5-methoxy-5-methyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2-methylbutanoate.
| Compound Name | (5-methoxy-5-methyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 130310997 |
| Molecular Formula | C15H23IO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (5-methoxy-5-methyl-4-oxatricyclo[4.2.1.03,7]nonan-2-yl) 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1C2CC3C1OC(C)(OC)C3C2 |
| InChI | InChI=1S/C15H23IO4/c1-5-14(2,16)13(17)19-11-8-6-9-10(7-8)15(3,18-4)20-12(9)11/h8-12H,5-7H2,1-4H3 |
| InChIKey | HUDPTXPIOGKGCR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|