C16H25IO3 — CID 163524833
[4-(hydroxymethyl)-7-tricyclo[4.3.1.01,3]decanyl] 2-iodo-2-methylbutanoate (PubChem CID 163524833) has the molecular formula C16H25IO3 and a molecular weight of 392.28 g/mol. Its IUPAC name is [4-(hydroxymethyl)-7-tricyclo[4.3.1.01,3]decanyl] 2-iodo-2-methylbutanoate.
| Compound Name | [4-(hydroxymethyl)-7-tricyclo[4.3.1.01,3]decanyl] 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 163524833 |
| Molecular Formula | C16H25IO3 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [4-(hydroxymethyl)-7-tricyclo[4.3.1.01,3]decanyl] 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC1CCC23CC1CC(CO)C2C3 |
| InChI | InChI=1S/C16H25IO3/c1-3-15(2,17)14(19)20-13-4-5-16-7-10(13)6-11(9-18)12(16)8-16/h10-13,18H,3-9H2,1-2H3 |
| InChIKey | DNWAXVWZFVLRRM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|