C16H27IO3 — CID 163432299
[3-(hydroxymethyl)-3-methyl-1-bicyclo[3.3.1]nonanyl] 2-iodo-2-methylbutanoate (PubChem CID 163432299) has the molecular formula C16H27IO3 and a molecular weight of 394.29 g/mol. Its IUPAC name is [3-(hydroxymethyl)-3-methyl-1-bicyclo[3.3.1]nonanyl] 2-iodo-2-methylbutanoate.
| Compound Name | [3-(hydroxymethyl)-3-methyl-1-bicyclo[3.3.1]nonanyl] 2-iodo-2-methylbutanoate |
|---|---|
| PubChem CID | 163432299 |
| Molecular Formula | C16H27IO3 |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [3-(hydroxymethyl)-3-methyl-1-bicyclo[3.3.1]nonanyl] 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OC12CCCC(CC(C)(CO)C1)C2 |
| InChI | InChI=1S/C16H27IO3/c1-4-15(3,17)13(19)20-16-7-5-6-12(9-16)8-14(2,10-16)11-18/h12,18H,4-11H2,1-3H3 |
| InChIKey | AROLBJZVLYEPPN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|