C14H24O4 — CID 172793348
2-(3,3-dimethylcyclohexyl)oxycarbonyl-2-methylbutanoic acid (PubChem CID 172793348) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-(3,3-dimethylcyclohexyl)oxycarbonyl-2-methylbutanoic acid.
| Compound Name | 2-(3,3-dimethylcyclohexyl)oxycarbonyl-2-methylbutanoic acid |
|---|---|
| PubChem CID | 172793348 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-(3,3-dimethylcyclohexyl)oxycarbonyl-2-methylbutanoic acid |
| SMILES | CCC(C)(C(=O)O)C(=O)OC1CCCC(C)(C)C1 |
| InChI | InChI=1S/C14H24O4/c1-5-14(4,11(15)16)12(17)18-10-7-6-8-13(2,3)9-10/h10H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | PWGCZKGWWHMGQR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|