C14H26O2 — CID 144518048
methyl 2-(3,3-dimethylcycloheptyl)-2-methylpropanoate (PubChem CID 144518048) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is methyl 2-(3,3-dimethylcycloheptyl)-2-methylpropanoate.
| Compound Name | methyl 2-(3,3-dimethylcycloheptyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 144518048 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | methyl 2-(3,3-dimethylcycloheptyl)-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)C1CCCCC(C)(C)C1 |
| InChI | InChI=1S/C14H26O2/c1-13(2)9-7-6-8-11(10-13)14(3,4)12(15)16-5/h11H,6-10H2,1-5H3 |
| InChIKey | LARWLWDNICFDHN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |