About (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate
(3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate (PubChem CID 129121521) has the molecular formula C16H25IO3
and a molecular weight of 392.28 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate.
Molecular Properties
| Compound Name | (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate |
| PubChem CID | 129121521 |
| Molecular Formula | C16H25IO3 |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate |
| SMILES | CCC(C)(I)C(=O)OCC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C16H25IO3/c1-3-14(2,17)13(18)20-10-15-5-11-4-12(6-15)8-16(19,7-11)9-15/h11-12,19H,3-10H2,1-2H3 |
| InChIKey | YGRVHNUMMLPOBL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate?
The IUPAC name of (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate (CID 129121521) is (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate.
What is the SMILES notation for (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate?
The canonical SMILES for (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate is CCC(C)(I)C(=O)OCC12CC3CC(CC(O)(C3)C1)C2.
What is the InChIKey of (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate?
The InChIKey is YGRVHNUMMLPOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25IO3/c1-3-14(2,17)13(18)20-10-15-5-11-4-12(6-15)8-16(19,7-11)9-15/h11-12,19H,3-10H2,1-2H3.
What are the key properties of (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate?
(3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate has a molecular weight of 392.28 g/mol, XLogP of 3.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-1-adamantyl)methyl 2-iodo-2-methylbutanoate is sourced from PubChem (CID 129121521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).