C18H24F2O6 — CID 69474536
(3-hydroxy-1-adamantyl)methyl 4-(2,2-difluoropropanoyloxy)-3-oxobutanoate (PubChem CID 69474536) has the molecular formula C18H24F2O6 and a molecular weight of 374.38 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl)methyl 4-(2,2-difluoropropanoyloxy)-3-oxobutanoate.
| Compound Name | (3-hydroxy-1-adamantyl)methyl 4-(2,2-difluoropropanoyloxy)-3-oxobutanoate |
|---|---|
| PubChem CID | 69474536 |
| Molecular Formula | C18H24F2O6 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (3-hydroxy-1-adamantyl)methyl 4-(2,2-difluoropropanoyloxy)-3-oxobutanoate |
| SMILES | CC(F)(F)C(=O)OCC(=O)CC(=O)OCC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C18H24F2O6/c1-16(19,20)15(23)25-8-13(21)3-14(22)26-10-17-4-11-2-12(5-17)7-18(24,6-11)9-17/h11-12,24H,2-10H2,1H3 |
| InChIKey | RMUQFVUJPQCYPO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|